CAS 438221-57-9 is the registry number for 5-(2-Bromophenoxymethyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(2-bromophenoxy)methyl]furan-2-carbaldehyde (CAS 438221-57-9) is a chemical compound with the molecular formula C12H9BrO3 and a molecular weight of 281.10 g/mol. IUPAC name: 5-[(2-bromophenoxy)methyl]furan-2-carbaldehyde. InChIKey: MXSIOCHELDQBTL-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO3 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 5-[(2-bromophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | MXSIOCHELDQBTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC=C(O2)C=O)Br |
Computed by PubChem (NCBI)