Products 2767647-44-7

CAS 2767647-44-7 is the registry number for 8-Bromo-2-methoxy-1-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-bromo-2-methoxynaphthalene-1-carboxylic acid (CAS 2767647-44-7) is a chemical compound with the molecular formula C12H9BrO3 and a molecular weight of 281.10 g/mol. IUPAC name: 8-bromo-2-methoxynaphthalene-1-carboxylic acid. InChIKey: KNKSFCWCBGLSGY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BrO3
Molecular weight281.10 g/mol
IUPAC name8-bromo-2-methoxynaphthalene-1-carboxylic acid
InChIKeyKNKSFCWCBGLSGY-UHFFFAOYSA-N
SMILESCOC1=C(C2=C(C=CC=C2Br)C=C1)C(=O)O

Computed by PubChem (NCBI)