CAS 1233-79-0 appears in our catalog under these names: (S)-3-(((benzyloxy)carbonyl)amino)-2-phenylpropanoic acid, 98%, (S)-3-(((benzyloxy)carbonyl)amino)-2-phenylpropanoic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S)-2-phenyl-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 1233-79-0) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-2-phenyl-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: OHZVNLINVSOJDW-OAHLLOKOSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-2-phenyl-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | OHZVNLINVSOJDW-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC[C@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)