Products 123301-48-4

CAS 123301-48-4 is the registry number for 2-Hydroxy-1,2,3-propanetricarboxylic Acid 2-Butyl Ester. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

3-butoxycarbonyl-3-hydroxypentanedioic acid (CAS 123301-48-4) is a chemical compound with the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. IUPAC name: 3-butoxycarbonyl-3-hydroxypentanedioic acid. InChIKey: CQRNWUIXDBFESJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O7
Molecular weight248.23 g/mol
IUPAC name3-butoxycarbonyl-3-hydroxypentanedioic acid
InChIKeyCQRNWUIXDBFESJ-UHFFFAOYSA-N
SMILESCCCCOC(=O)C(CC(=O)O)(CC(=O)O)O

Computed by PubChem (NCBI)