CAS 289697-66-1 is the registry number for 2,3-Dideoxy-2-methylene-D-glycero-D-galacto-nononic Acid Gamma-Lactone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 500mg.
(5S)-3-methylidene-5-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]oxolan-2-one (CAS 289697-66-1) is a chemical compound with the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. IUPAC name: (5S)-3-methylidene-5-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]oxolan-2-one. InChIKey: UMKGNATWHHYUEM-WUNNTHRKSA-N.
| Molecular formula | C10H16O7 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | (5S)-3-methylidene-5-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]oxolan-2-one |
| InChIKey | UMKGNATWHHYUEM-WUNNTHRKSA-N |
| SMILES | C=C1C[C@H](OC1=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)