Products 19958-02-2
CAS 19958-02-2 appears in our catalog under these names: Citric acid Impurity 5, Citric Acid 1,2-Diethyl Ester, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g, 250mg.
5-ethoxy-3-ethoxycarbonyl-3-hydroxy-5-oxopentanoic acid (CAS 19958-02-2) is a chemical compound with the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. IUPAC name: 5-ethoxy-3-ethoxycarbonyl-3-hydroxy-5-oxopentanoic acid. InChIKey: KGYXYKHTHJPEBX-UHFFFAOYSA-N.
| Molecular formula | C10H16O7 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-ethoxy-3-ethoxycarbonyl-3-hydroxy-5-oxopentanoic acid |
| InChIKey | KGYXYKHTHJPEBX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(CC(=O)O)(C(=O)OCC)O |
Computed by PubChem (NCBI)
Synonyms:
Diethyl citrate, 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, diethyl ester, Citric Acid 1,2-Diethyl Ester, 1,2-Diethyl citrate, Asym-Diethyl Citrate, Citric acid, 1,2-diethyl ester, Diethyl hydrogen 2-hydroxypropane-1,2,3-tricarboxylate, 1,2-Diethyl citrate, (+/-)-, 5-ethoxy-3-ethoxycarbonyl-3-hydroxy-5-oxopentanoic acid, 5-ethoxy-3-(ethoxycarbonyl)-3-hydroxy-5-oxopentanoic acid