Products 1233010-48-4
CAS 1233010-48-4 is the registry number for 1-Amino-cis-2,6-dimethylpiperidine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2S,6R)-2,6-dimethylpiperidin-1-amine;hydrochloride (CAS 1233010-48-4) is a chemical compound with the molecular formula C7H17ClN2 and a molecular weight of 164.67 g/mol. IUPAC name: (2S,6R)-2,6-dimethylpiperidin-1-amine;hydrochloride. InChIKey: HLKWEBRKGNCOFD-UKMDXRBESA-N.
| Molecular formula | C7H17ClN2 |
|---|---|
| Molecular weight | 164.67 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethylpiperidin-1-amine;hydrochloride |
| InChIKey | HLKWEBRKGNCOFD-UKMDXRBESA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1N)C.Cl |
Computed by PubChem (NCBI)