CAS 1233055-24-7 appears in our catalog under these names: 3-(4-Bromo-2-chlorophenyl)acrylic acid, 95%, 4-Bromo-2-chlorocinnamic acid, 3-(4-Bromo-2-chlorophenyl)acrylic acid, 95% +(E), 95% +(E), 4-BROMO-2-CHLOROCINNAMIC ACID, 96%, 3-(4-Bromo-2-chlorophenyl)acrylic acid, 95% +(E). Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 2000mg, 1000mg, 5000mg, 10000mg, 25g.
(E)-3-(4-bromo-2-chlorophenyl)prop-2-enoic acid (CAS 1233055-24-7) is a chemical compound with the molecular formula C9H6BrClO2 and a molecular weight of 261.50 g/mol. IUPAC name: (E)-3-(4-bromo-2-chlorophenyl)prop-2-enoic acid. InChIKey: IQASDWBWCLYMJB-DUXPYHPUSA-N.
| Molecular formula | C9H6BrClO2 |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | (E)-3-(4-bromo-2-chlorophenyl)prop-2-enoic acid |
| InChIKey | IQASDWBWCLYMJB-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)