CAS 890839-47-1 appears in our catalog under these names: 8-Bromo-6-chloro-3,4-dihydro-2h-1-benzopyran-4-one, 95%, 8-Bromo-6-chloro-2,3-dihydro-4H-chromen-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
8-bromo-6-chloro-2,3-dihydrochromen-4-one (CAS 890839-47-1) is a chemical compound with the molecular formula C9H6BrClO2 and a molecular weight of 261.50 g/mol. IUPAC name: 8-bromo-6-chloro-2,3-dihydrochromen-4-one. InChIKey: YSDPWUIFEAAHIG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO2 |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | 8-bromo-6-chloro-2,3-dihydrochromen-4-one |
| InChIKey | YSDPWUIFEAAHIG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2Br)Cl |
Computed by PubChem (NCBI)