Products 2930864-31-4
CAS 2930864-31-4 is the registry number for 5-Bromo-7-chloro-2,3-dihydrobenzofuran-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde (CAS 2930864-31-4) is a chemical compound with the molecular formula C9H6BrClO2 and a molecular weight of 261.50 g/mol. IUPAC name: 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde. InChIKey: KMCKVMSDSZDGRB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO2 |
|---|---|
| Molecular weight | 261.50 g/mol |
| IUPAC name | 5-bromo-7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde |
| InChIKey | KMCKVMSDSZDGRB-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C(=C(C=C2Cl)Br)C=O |
Computed by PubChem (NCBI)