CAS 1233086-45-7 appears in our catalog under these names: 1-(1,1-Dimethylethyl) 2-ethyl 5-(bromomethyl)-1H-indole-1,2-dicarboxylate, 1-tert-butyl 2-ethyl 5-(bromomethyl)-1H-indole-1,2-dicarboxylate, 98%. Offered by: TRC, AmBeed. Available pack sizes: 1g, 5g.
1-O-tert-butyl 2-O-ethyl 5-(bromomethyl)indole-1,2-dicarboxylate (CAS 1233086-45-7) is a chemical compound with the molecular formula C17H20BrNO4 and a molecular weight of 382.2 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 5-(bromomethyl)indole-1,2-dicarboxylate. InChIKey: NIGWCDZLIPKLMO-UHFFFAOYSA-N.
| Molecular formula | C17H20BrNO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 5-(bromomethyl)indole-1,2-dicarboxylate |
| InChIKey | NIGWCDZLIPKLMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)CBr |
Computed by PubChem (NCBI)