Products 1291076-20-4
CAS 1291076-20-4 is the registry number for 6-Bromo-3,4-dihydro-4-oxo-spiro[2h-1-benzopyran-2,3'-pyrrolidine]-1'-carboxylic acid 1,1-dimethylethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxylate (CAS 1291076-20-4) is a chemical compound with the molecular formula C17H20BrNO4 and a molecular weight of 382.2 g/mol. IUPAC name: tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxylate. InChIKey: VBEBEHLQQRHZSW-UHFFFAOYSA-N.
| Molecular formula | C17H20BrNO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxylate |
| InChIKey | VBEBEHLQQRHZSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)