Products 3371-33-3
CAS 3371-33-3 appears in our catalog under these names: Fenoterol Impurity 2（Fenoterol EP Impurity B）, 3',5'-Dihydroxy-2-((2-(p-hydroxyphenyl)-1-methylethyl)amino)-acetophenone Hydrobromide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrobromide (CAS 3371-33-3) is a chemical compound with the molecular formula C17H20BrNO4 and a molecular weight of 382.2 g/mol. IUPAC name: 1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrobromide. InChIKey: JDHLKARRBHHTQB-UHFFFAOYSA-N.
| Molecular formula | C17H20BrNO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | 1-(3,5-dihydroxyphenyl)-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethanone;hydrobromide |
| InChIKey | JDHLKARRBHHTQB-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)O)NCC(=O)C2=CC(=CC(=C2)O)O.Br |
Computed by PubChem (NCBI)