CAS 123334-16-7 appears in our catalog under these names: Tetrahydroxy–1,4–benzoquinone Hydrate, Tetrahydroxy-1,4-benzoquinone Hydrate, >96.0%(T), Tetrahydroxy-1,4-quinone 97%, 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate, 97%, 97%, 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
2,3,5,6-tetrahydroxycyclohexa-2,5-diene-1,4-dione;hydrate (CAS 123334-16-7) is a chemical compound with the molecular formula C6H6O7 and a molecular weight of 190.11 g/mol. IUPAC name: 2,3,5,6-tetrahydroxycyclohexa-2,5-diene-1,4-dione;hydrate. InChIKey: CJFTUKFVMMYYHH-UHFFFAOYSA-N.
| Molecular formula | C6H6O7 |
|---|---|
| Molecular weight | 190.11 g/mol |
| IUPAC name | 2,3,5,6-tetrahydroxycyclohexa-2,5-diene-1,4-dione;hydrate |
| InChIKey | CJFTUKFVMMYYHH-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=O)C(=C(C1=O)O)O)O)O.O |
Computed by PubChem (NCBI)