Products 1948-82-9
CAS 1948-82-9 is the registry number for Oxalosuccinic acid. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Oxalosuccinic acid is a tricarboxylic acid consisting of 2-oxoglutaric acid having a further carboxy group at the 3-position. It is a substrate of the citric acid cycle. It has a role as a fundamental metabolite. It is functionally related to a 2-oxoglutaric acid. It is a conjugate acid of an oxalatosuccinate(3-).
Source: ChEBI
| Molecular formula | C6H6O7 |
|---|---|
| Molecular weight | 190.11 g/mol |
| IUPAC name | 1-oxopropane-1,2,3-tricarboxylic acid |
| InChIKey | UFSCUAXLTRFIDC-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)