Products 5781-55-5
CAS 5781-55-5 appears in our catalog under these names: Methoxalic Anhydride, 2-methoxy-2-oxoacetic anhydride. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-(2-methoxy-2-oxoacetyl) 1-O-methyl oxalate (CAS 5781-55-5) is a chemical compound with the molecular formula C6H6O7 and a molecular weight of 190.11 g/mol. IUPAC name: 2-O-(2-methoxy-2-oxoacetyl) 1-O-methyl oxalate. InChIKey: JKFKZGGSAYSSBN-UHFFFAOYSA-N.
| Molecular formula | C6H6O7 |
|---|---|
| Molecular weight | 190.11 g/mol |
| IUPAC name | 2-O-(2-methoxy-2-oxoacetyl) 1-O-methyl oxalate |
| InChIKey | JKFKZGGSAYSSBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)OC(=O)C(=O)OC |
Computed by PubChem (NCBI)