CAS 1233541-64-4 is the registry number for 4-Ethoxy-2-fluorobenzotrifluoride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-ethoxy-2-fluoro-1-(trifluoromethyl)benzene (CAS 1233541-64-4) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 4-ethoxy-2-fluoro-1-(trifluoromethyl)benzene. InChIKey: DIQPDWNLROTSAR-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 4-ethoxy-2-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | DIQPDWNLROTSAR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)