CAS 123375-88-2 is the registry number for 6-Amino-2-[(2,4-dichlorophenyl)amino]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-2-(2,4-dichloroanilino)-1H-pyrimidin-6-one (CAS 123375-88-2) is a chemical compound with the molecular formula C10H8Cl2N4O and a molecular weight of 271.10 g/mol. IUPAC name: 4-amino-2-(2,4-dichloroanilino)-1H-pyrimidin-6-one. InChIKey: POCXXULHQCBCNW-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4O |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 4-amino-2-(2,4-dichloroanilino)-1H-pyrimidin-6-one |
| InChIKey | POCXXULHQCBCNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC2=NC(=CC(=O)N2)N |
Computed by PubChem (NCBI)