CAS 154221-27-9 is the registry number for Imibenconazole-desbenzyl-oxon. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
N-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)acetamide (CAS 154221-27-9) is a chemical compound with the molecular formula C10H8Cl2N4O and a molecular weight of 271.10 g/mol. IUPAC name: N-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)acetamide. InChIKey: SUABSSUUOLEOOZ-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4O |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)acetamide |
| InChIKey | SUABSSUUOLEOOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=O)CN2C=NN=C2 |
Computed by PubChem (NCBI)