Products 90626-46-3
CAS 90626-46-3 is the registry number for 2-(2,6-Dichlorophenyl)-N-(4H-1,2,4-triazol-3-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)acetamide (CAS 90626-46-3) is a chemical compound with the molecular formula C10H8Cl2N4O and a molecular weight of 271.10 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)acetamide. InChIKey: DWZDYMRDMSOWIZ-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4O |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
| InChIKey | DWZDYMRDMSOWIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)NC2=NC=NN2)Cl |
Computed by PubChem (NCBI)