Products 1234045-56-7
CAS 1234045-56-7 is the registry number for Mirogabalin Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-2-enyl]acetic acid (CAS 1234045-56-7) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: 2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-2-enyl]acetic acid. InChIKey: FMDBATHVBMMPSG-NHCYSSNCSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | 2-[(1R,5S,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-2-enyl]acetic acid |
| InChIKey | FMDBATHVBMMPSG-NHCYSSNCSA-N |
| SMILES | CCC1=C[C@H]2C[C@]([C@H]2C1)(CC(=O)O)CN |
Computed by PubChem (NCBI)