CAS 1234616-75-1 is the registry number for 4-Nitro-1h-pyrazolo[3,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4-nitro-1H-pyrazolo[3,4-b]pyridine (CAS 1234616-75-1) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 4-nitro-1H-pyrazolo[3,4-b]pyridine. InChIKey: KFUONTSQILUGSY-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 4-nitro-1H-pyrazolo[3,4-b]pyridine |
| InChIKey | KFUONTSQILUGSY-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1[N+](=O)[O-])C=NN2 |
Computed by PubChem (NCBI)