CAS 13480-40-5 appears in our catalog under these names: 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione, 95%, 5H,6H,7H,8H-Pyrazino(2,3-d)pyridazine-5,8-dione, 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione, 95%, 95%, 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione, 95.18%, 6,7-Dihydropyrazino[2,3-d]pyridazine-5,8-dione (Standard). Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 25mg, 100mg, 100 mg.
6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione (CAS 13480-40-5) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione. InChIKey: MODLYLCAANSASD-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione |
| InChIKey | MODLYLCAANSASD-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=O)NNC2=O |
Computed by PubChem (NCBI)