CAS 91144-81-9 is the registry number for 5-Pyrazin-2-yl-1,3,4-oxadiazol-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-pyrazin-2-yl-3H-1,3,4-oxadiazol-2-one (CAS 91144-81-9) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 5-pyrazin-2-yl-3H-1,3,4-oxadiazol-2-one. InChIKey: XZMSQFXKJVQENL-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-pyrazin-2-yl-3H-1,3,4-oxadiazol-2-one |
| InChIKey | XZMSQFXKJVQENL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NNC(=O)O2 |
Computed by PubChem (NCBI)