CAS 17257-96-4 appears in our catalog under these names: Pyrimido[4,5-d]pyridazine-2,4(1H,3H)-dione, 95%, Pyrimido(4,5–d)pyridazine–2,4(1H,3H)–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
1H-pyrimido[4,5-d]pyridazine-2,4-dione (CAS 17257-96-4) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 1H-pyrimido[4,5-d]pyridazine-2,4-dione. InChIKey: OXXOHYAWQSFGSU-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1H-pyrimido[4,5-d]pyridazine-2,4-dione |
| InChIKey | OXXOHYAWQSFGSU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=N1)NC(=O)NC2=O |
Computed by PubChem (NCBI)