Products 1234790-17-0
CAS 1234790-17-0 is the registry number for 4-Bromo-5-methylphthalamide, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-bromo-5-methylbenzene-1,2-dicarboxamide (CAS 1234790-17-0) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 4-bromo-5-methylbenzene-1,2-dicarboxamide. InChIKey: NLXXUFDYTQDMMP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 4-bromo-5-methylbenzene-1,2-dicarboxamide |
| InChIKey | NLXXUFDYTQDMMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)