CAS 1234842-62-6 appears in our catalog under these names: (R)–N–Acetyl–6–Fluoro–Trp–OMe, (R)-N-Acetyl-6-fluoro-trp-ome, 95%, Methyl (R)-2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoate. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 250mg.
Methyl (2R)-2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoate (CAS 1234842-62-6) is a chemical compound with the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoate. InChIKey: CIJWYGWNKOFQDQ-CYBMUJFWSA-N.
| Molecular formula | C14H15FN2O3 |
|---|---|
| Molecular weight | 278.28 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoate |
| InChIKey | CIJWYGWNKOFQDQ-CYBMUJFWSA-N |
| SMILES | CC(=O)N[C@H](CC1=CNC2=C1C=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)