Products 1620445-19-3

CAS 1620445-19-3 is the registry number for Norfloxacin Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-ethyl-7-(ethylamino)-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 1620445-19-3) is a chemical compound with the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. IUPAC name: 1-ethyl-7-(ethylamino)-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: ZEVKILPCDAQOMC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15FN2O3
Molecular weight278.28 g/mol
IUPAC name1-ethyl-7-(ethylamino)-6-fluoro-4-oxoquinoline-3-carboxylic acid
InChIKeyZEVKILPCDAQOMC-UHFFFAOYSA-N
SMILESCCNC1=C(C=C2C(=C1)N(C=C(C2=O)C(=O)O)CC)F

Computed by PubChem (NCBI)