Products 2197062-18-1

CAS 2197062-18-1 is the registry number for 2-(4-Fluoro-2-(tetrahydro-2h-pyran-4-yl)-1h-benzo[d]imidazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[4-fluoro-2-(oxan-4-yl)benzimidazol-1-yl]acetic acid (CAS 2197062-18-1) is a chemical compound with the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. IUPAC name: 2-[4-fluoro-2-(oxan-4-yl)benzimidazol-1-yl]acetic acid. InChIKey: ZRGJJFRFFPCXER-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15FN2O3
Molecular weight278.28 g/mol
IUPAC name2-[4-fluoro-2-(oxan-4-yl)benzimidazol-1-yl]acetic acid
InChIKeyZRGJJFRFFPCXER-UHFFFAOYSA-N
SMILESC1COCCC1C2=NC3=C(N2CC(=O)O)C=CC=C3F

Computed by PubChem (NCBI)