Products 1234857-01-2
CAS 1234857-01-2 is the registry number for 4-Amino-8-methylquinoline-3-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-amino-8-methylquinoline-3-carboxylic acid (CAS 1234857-01-2) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 4-amino-8-methylquinoline-3-carboxylic acid. InChIKey: YMAZADGQTGKGCZ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-amino-8-methylquinoline-3-carboxylic acid |
| InChIKey | YMAZADGQTGKGCZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(C=N2)C(=O)O)N |
Computed by PubChem (NCBI)