CAS 1234863-36-5 appears in our catalog under these names: (R)-1-(1H-benzo[d]imidazol-2-yl)-2-methylpropan-1-amine hydrochloride, 98%, 98%, (R)-1-(1H-benzo[d]imidazol-2-yl)-2-methylpropan-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;hydrochloride (CAS 1234863-36-5) is a chemical compound with the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. IUPAC name: (1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;hydrochloride. InChIKey: CYUBREHSYAXDSI-HNCPQSOCSA-N.
| Molecular formula | C11H16ClN3 |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | (1R)-1-(1H-benzimidazol-2-yl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | CYUBREHSYAXDSI-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H](C1=NC2=CC=CC=C2N1)N.Cl |
Computed by PubChem (NCBI)