CAS 1234996-74-7 appears in our catalog under these names: (R)-1-(1H-Benzimidazol-2-yl)ethylamine hydrochloride, 95%, (R)-1-(1H-Benzimidazol-2-yl)ethylamine Hydrochloride, 97%, (R)–1–(1H–Benzimidazol–2–yl)ethylamine Hydrochloride, (R)-1-(1H-Benzimidazol-2-yl)ethylamine, HCl, 95%, 95%, (R)-1-(1H-BENZIMIDAZOL-2-YL)ETHYLAMINE HCL, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(1R)-1-(1H-benzimidazol-2-yl)ethanamine;hydrochloride (CAS 1234996-74-7) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: (1R)-1-(1H-benzimidazol-2-yl)ethanamine;hydrochloride. InChIKey: HFHWHWCRHSKBOZ-FYZOBXCZSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (1R)-1-(1H-benzimidazol-2-yl)ethanamine;hydrochloride |
| InChIKey | HFHWHWCRHSKBOZ-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=NC2=CC=CC=C2N1)N.Cl |
Computed by PubChem (NCBI)