Products 1235138-34-7
CAS 1235138-34-7 appears in our catalog under these names: Methyl 4-amino-6-indolecarboxylate hydrochloride, 95%, Methyl 4–Amino–6–indolecarboxylate Hydrochloride, Methyl 4-amino-6-indolecarboxylate, HCl, >97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg.
Methyl 4-amino-1H-indole-6-carboxylate;hydrochloride (CAS 1235138-34-7) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: methyl 4-amino-1H-indole-6-carboxylate;hydrochloride. InChIKey: HZAYUVWSZONRIE-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | methyl 4-amino-1H-indole-6-carboxylate;hydrochloride |
| InChIKey | HZAYUVWSZONRIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C=CNC2=C1)N.Cl |
Computed by PubChem (NCBI)