CAS 1235374-44-3 appears in our catalog under these names: 4-Amino-7-bromoimidazo[2,1-f][1,2,4]triazine, 97%, 7–Bromoimidazo(2,1–f)(1,2,4)triazin–4–amine, 7-Bromoimidazo[2,1-f][1,2,4]triazin-4-amine 95%, 7-Bromoimidazo[2,1-f][1,2,4]triazin-4-amine, 95%, 95%, 7-Bromoimidazo[2,1-f][1,2,4]triazin-4-amine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine (CAS 1235374-44-3) is a chemical compound with the molecular formula C5H4BrN5 and a molecular weight of 214.02 g/mol. IUPAC name: 7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine. InChIKey: TUTGYFIEADAVJN-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN5 |
|---|---|
| Molecular weight | 214.02 g/mol |
| IUPAC name | 7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine |
| InChIKey | TUTGYFIEADAVJN-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=N1)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)