CAS 82499-03-4 appears in our catalog under these names: 2-Amino-6-bromopurine, 98%, 2-Amino-6-bromopurine, 98% , 2-AMINO-6-BROMOPURINE, 95%, 2-Amino-6-bromopurine, 98%, 98%, 6-Bromo-7H-purin-2-amine, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
6-bromo-7H-purin-2-amine (CAS 82499-03-4) is a chemical compound with the molecular formula C5H4BrN5 and a molecular weight of 214.02 g/mol. IUPAC name: 6-bromo-7H-purin-2-amine. InChIKey: HPGBGNVPUMCKPM-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN5 |
|---|---|
| Molecular weight | 214.02 g/mol |
| IUPAC name | 6-bromo-7H-purin-2-amine |
| InChIKey | HPGBGNVPUMCKPM-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)N)Br |
Computed by PubChem (NCBI)