CAS 6974-78-3 appears in our catalog under these names: 8-Bromoadenine, 95%, 8-Bromoadenine, >95% (HPLC), 8–Bromoadenine, 8-Bromoadenine , 8-Bromoadenine. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 10g, 5g, 2g, 250mg, 2,5g, 100mg, 25mg.
8-bromo-7H-purin-6-amine (CAS 6974-78-3) is a chemical compound with the molecular formula C5H4BrN5 and a molecular weight of 214.02 g/mol. IUPAC name: 8-bromo-7H-purin-6-amine. InChIKey: FVXHPCVBOXMRJP-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN5 |
|---|---|
| Molecular weight | 214.02 g/mol |
| IUPAC name | 8-bromo-7H-purin-6-amine |
| InChIKey | FVXHPCVBOXMRJP-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N=C(N2)Br)N |
Computed by PubChem (NCBI)