CAS 1235439-12-9 appears in our catalog under these names: 3-([2-(2,4-Difluorophenyl)-2-oxoethyl]carbamoyl)propanoic acid, 95%, 3-{(2-(2,4-difluorophenyl)-2-oxoethyl)carbamoyl}propanoic acid, 95%, 3-{(2-(2,4-Difluorophenyl)-2-oxoethyl)carbamoyl}propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-[[2-(2,4-difluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid (CAS 1235439-12-9) is a chemical compound with the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. IUPAC name: 4-[[2-(2,4-difluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid. InChIKey: QUDOFUBQPOMQBS-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO4 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 4-[[2-(2,4-difluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid |
| InChIKey | QUDOFUBQPOMQBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)