Products 926199-54-4
CAS 926199-54-4 is the registry number for Methyl 4-(difluoromethoxy)-5-methoxy-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-(difluoromethoxy)-5-methoxy-1H-indole-2-carboxylate (CAS 926199-54-4) is a chemical compound with the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. IUPAC name: methyl 4-(difluoromethoxy)-5-methoxy-1H-indole-2-carboxylate. InChIKey: GXJMTRHFAWEIDK-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO4 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | methyl 4-(difluoromethoxy)-5-methoxy-1H-indole-2-carboxylate |
| InChIKey | GXJMTRHFAWEIDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=C2)C(=O)OC)OC(F)F |
Computed by PubChem (NCBI)