CAS 1784747-94-9 is the registry number for Rel-(3R,4S)-4-(4-(difluoromethoxy)phenyl)-2-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-[4-(difluoromethoxy)phenyl]-2-oxopyrrolidine-3-carboxylic acid (CAS 1784747-94-9) is a chemical compound with the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. IUPAC name: (3R,4S)-4-[4-(difluoromethoxy)phenyl]-2-oxopyrrolidine-3-carboxylic acid. InChIKey: SFMSYOBSERHLPD-RKDXNWHRSA-N.
| Molecular formula | C12H11F2NO4 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | (3R,4S)-4-[4-(difluoromethoxy)phenyl]-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | SFMSYOBSERHLPD-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@H](C(=O)N1)C(=O)O)C2=CC=C(C=C2)OC(F)F |
Computed by PubChem (NCBI)