Products 1235439-58-3
CAS 1235439-58-3 is the registry number for Methyl 5-bromo-2H-chromene-8-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-bromo-2H-chromene-8-carboxylate (CAS 1235439-58-3) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: methyl 5-bromo-2H-chromene-8-carboxylate. InChIKey: WJOISXQWAFCSLT-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | methyl 5-bromo-2H-chromene-8-carboxylate |
| InChIKey | WJOISXQWAFCSLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=C(C=C1)Br)C=CCO2 |
Computed by PubChem (NCBI)