CAS 1235440-00-2 appears in our catalog under these names: (3-Bromo-4,5-dimethoxyphenyl)methanamine hydrochloride, 95%, (3-Bromo-4,5-dimethoxyphenyl)methanamine hydrochloride, 98%, (3-Bromo-4,5-dimethoxyphenyl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(3-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride (CAS 1235440-00-2) is a chemical compound with the molecular formula C9H13BrClNO2 and a molecular weight of 282.56 g/mol. IUPAC name: (3-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: GTMBLMCEHRGXGP-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO2 |
|---|---|
| Molecular weight | 282.56 g/mol |
| IUPAC name | (3-bromo-4,5-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | GTMBLMCEHRGXGP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CN)Br)OC.Cl |
Computed by PubChem (NCBI)