CAS 1391054-36-6 is the registry number for rac 4-Bromo Phenylephrine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-bromo-5-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 1391054-36-6) is a chemical compound with the molecular formula C9H13BrClNO2 and a molecular weight of 282.56 g/mol. IUPAC name: 2-bromo-5-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: GOSYYRQYGQXWJT-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO2 |
|---|---|
| Molecular weight | 282.56 g/mol |
| IUPAC name | 2-bromo-5-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | GOSYYRQYGQXWJT-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=C(C=C1)Br)O)O.Cl |
Computed by PubChem (NCBI)