Products 1391053-54-5

CAS 1391053-54-5 is the registry number for rac 6-Bromo Phenylephrine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 1391053-54-5) is a chemical compound with the molecular formula C9H13BrClNO2 and a molecular weight of 282.56 g/mol. IUPAC name: 4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: VITXUJKAFSLXMY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BrClNO2
Molecular weight282.56 g/mol
IUPAC name4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride
InChIKeyVITXUJKAFSLXMY-UHFFFAOYSA-N
SMILESCNCC(C1=C(C=CC(=C1)O)Br)O.Cl

Computed by PubChem (NCBI)