CAS 1391053-54-5 is the registry number for rac 6-Bromo Phenylephrine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg.
4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 1391053-54-5) is a chemical compound with the molecular formula C9H13BrClNO2 and a molecular weight of 282.56 g/mol. IUPAC name: 4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: VITXUJKAFSLXMY-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO2 |
|---|---|
| Molecular weight | 282.56 g/mol |
| IUPAC name | 4-bromo-3-[1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | VITXUJKAFSLXMY-UHFFFAOYSA-N |
| SMILES | CNCC(C1=C(C=CC(=C1)O)Br)O.Cl |
Computed by PubChem (NCBI)