Products 1235568-08-7
CAS 1235568-08-7 is the registry number for Dimethyl 3-Bromo-5-fluorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
3-bromo-5-fluoro-N,N-dimethylbenzamide (CAS 1235568-08-7) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-5-fluoro-N,N-dimethylbenzamide. InChIKey: LFOCQCFERXNWNR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | LFOCQCFERXNWNR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)