Products 1235568-92-9
CAS 1235568-92-9 appears in our catalog under these names: 4'-Isobutoxybiphenyl-4-ylboronic acid, 95%, 4-(4'-Isobutoxyphenyl)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[4-[4-(2-methylpropoxy)phenyl]phenyl]boronic acid (CAS 1235568-92-9) is a chemical compound with the molecular formula C16H19BO3 and a molecular weight of 270.1 g/mol. IUPAC name: [4-[4-(2-methylpropoxy)phenyl]phenyl]boronic acid. InChIKey: UYYMDDOZEZGXAY-UHFFFAOYSA-N.
| Molecular formula | C16H19BO3 |
|---|---|
| Molecular weight | 270.1 g/mol |
| IUPAC name | [4-[4-(2-methylpropoxy)phenyl]phenyl]boronic acid |
| InChIKey | UYYMDDOZEZGXAY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCC(C)C)(O)O |
Computed by PubChem (NCBI)