CAS 876316-28-8 is the registry number for 2-[2-(2-Furyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-[2-(furan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 876316-28-8) is a chemical compound with the molecular formula C16H19BO3 and a molecular weight of 270.1 g/mol. IUPAC name: 2-[2-(furan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IKVHPKPYKOEGCK-UHFFFAOYSA-N.
| Molecular formula | C16H19BO3 |
|---|---|
| Molecular weight | 270.1 g/mol |
| IUPAC name | 2-[2-(furan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IKVHPKPYKOEGCK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C3=CC=CO3 |
Computed by PubChem (NCBI)