CAS 1437769-83-9 appears in our catalog under these names: 3-Hydroxynaphthalene-2-boronic acid pinacol ester, 90%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-ol 90%, 3-Hydroxynaphthalene-2-boronic acid pinacol ester, 90%, 90%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-ol, 90%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-ol (CAS 1437769-83-9) is a chemical compound with the molecular formula C16H19BO3 and a molecular weight of 270.1 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-ol. InChIKey: ABMLEYBIIGSGCL-UHFFFAOYSA-N.
| Molecular formula | C16H19BO3 |
|---|---|
| Molecular weight | 270.1 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-ol |
| InChIKey | ABMLEYBIIGSGCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)