CAS 1235975-33-3 appears in our catalog under these names: 2-Amino-4-methyl-N-phenylbenzamide, 95%, 95%, 2-Amino-4-methyl-N-phenylbenzamide, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-amino-4-methyl-N-phenylbenzamide (CAS 1235975-33-3) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2-amino-4-methyl-N-phenylbenzamide. InChIKey: IJLKSEGXALROQY-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-amino-4-methyl-N-phenylbenzamide |
| InChIKey | IJLKSEGXALROQY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)