Products 1236060-57-3
CAS 1236060-57-3 is the registry number for N-(4-Bromo-3-nitrophenyl)-2,2-dimethylpropanamide. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-(4-bromo-3-nitrophenyl)-2,2-dimethylpropanamide (CAS 1236060-57-3) is a chemical compound with the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. IUPAC name: N-(4-bromo-3-nitrophenyl)-2,2-dimethylpropanamide. InChIKey: SOSMLOYWFSZDIJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O3 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | N-(4-bromo-3-nitrophenyl)-2,2-dimethylpropanamide |
| InChIKey | SOSMLOYWFSZDIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)