CAS 1260667-46-6 appears in our catalog under these names: 2-(Boc-amino)-5-bromoisonicotinaldehyde, 95%, 2–(Boc–amino)–5–bromoisonicotinaldehyde, tert-Butyl (5-bromo-4-formylpyridin-2-yl)carbamate 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl N-(5-bromo-4-formyl-2-pyridinyl)carbamate (CAS 1260667-46-6) is a chemical compound with the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. IUPAC name: tert-butyl N-(5-bromo-4-formyl-2-pyridinyl)carbamate. InChIKey: PFFUYNROGVVDIZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O3 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-4-formyl-2-pyridinyl)carbamate |
| InChIKey | PFFUYNROGVVDIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C(=C1)C=O)Br |
Computed by PubChem (NCBI)